C12H10F3N5O4 — CID 127031593
2-methyl-6-nitro-2-[[5-(trifluoromethyl)pyrazin-2-yl]oxymethyl]-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 127031593) has the molecular formula C12H10F3N5O4 and a molecular weight of 345.24 g/mol. Its IUPAC name is 2-methyl-6-nitro-2-[[5-(trifluoromethyl)pyrazin-2-yl]oxymethyl]-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | 2-methyl-6-nitro-2-[[5-(trifluoromethyl)pyrazin-2-yl]oxymethyl]-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 127031593 |
| Molecular Formula | C12H10F3N5O4 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2-methyl-6-nitro-2-[[5-(trifluoromethyl)pyrazin-2-yl]oxymethyl]-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | CC1(COc2cnc(C(F)(F)F)cn2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C12H10F3N5O4/c1-11(5-19-4-8(20(21)22)18-10(19)24-11)6-23-9-3-16-7(2-17-9)12(13,14)15/h2-4H,5-6H2,1H3 |
| InChIKey | JOHSHTQLTRXLHJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|