C9H12N4O5 — CID 69481298
[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl N-methylcarbamate (PubChem CID 69481298) has the molecular formula C9H12N4O5 and a molecular weight of 256.22 g/mol. Its IUPAC name is [(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl N-methylcarbamate.
| Compound Name | [(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 69481298 |
| Molecular Formula | C9H12N4O5 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | [(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OC[C@@]1(C)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C9H12N4O5/c1-9(5-17-8(14)10-2)4-12-3-6(13(15)16)11-7(12)18-9/h3H,4-5H2,1-2H3,(H,10,14)/t9-/m1/s1 |
| InChIKey | WRGXXJHOSYBTOU-SECBINFHSA-N |
| XLogP | 0.30 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|