C16H15ClN4O5 — CID 69481242
(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl 5-chloro-2,3-dihydroindole-1-carboxylate (PubChem CID 69481242) has the molecular formula C16H15ClN4O5 and a molecular weight of 378.77 g/mol. Its IUPAC name is (2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl 5-chloro-2,3-dihydroindole-1-carboxylate.
| Compound Name | (2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl 5-chloro-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 69481242 |
| Molecular Formula | C16H15ClN4O5 |
| Molecular Weight | 378.77 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | (2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl 5-chloro-2,3-dihydroindole-1-carboxylate |
| SMILES | CC1(COC(=O)N2CCc3cc(Cl)ccc32)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C16H15ClN4O5/c1-16(8-19-7-13(21(23)24)18-14(19)26-16)9-25-15(22)20-5-4-10-6-11(17)2-3-12(10)20/h2-3,6-7H,4-5,8-9H2,1H3 |
| InChIKey | NDCBGUDYKVSZEL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 99.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.77 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|