C17H17ClN4O5 — CID 69481394
[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl 6-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 69481394) has the molecular formula C17H17ClN4O5 and a molecular weight of 392.80 g/mol. Its IUPAC name is [(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl 6-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | [(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl 6-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 69481394 |
| Molecular Formula | C17H17ClN4O5 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | [(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl 6-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | C[C@]1(COC(=O)N2CCc3cc(Cl)ccc3C2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C17H17ClN4O5/c1-17(9-21-8-14(22(24)25)19-15(21)27-17)10-26-16(23)20-5-4-11-6-13(18)3-2-12(11)7-20/h2-3,6,8H,4-5,7,9-10H2,1H3/t17-/m1/s1 |
| InChIKey | TWABWGHNCTYWHL-QGZVFWFLSA-N |
| XLogP | 2.79 |
| TPSA | 99.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|