C15H16ClN5O3 — CID 122460942
(2S)-2-[(2-chloro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 122460942) has the molecular formula C15H16ClN5O3 and a molecular weight of 349.78 g/mol. Its IUPAC name is (2S)-2-[(2-chloro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | (2S)-2-[(2-chloro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 122460942 |
| Molecular Formula | C15H16ClN5O3 |
| Molecular Weight | 349.78 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | (2S)-2-[(2-chloro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | C[C@]1(CN2CCc3nc(Cl)ccc3C2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C15H16ClN5O3/c1-15(9-20-7-13(21(22)23)18-14(20)24-15)8-19-5-4-11-10(6-19)2-3-12(16)17-11/h2-3,7H,4-6,8-9H2,1H3/t15-/m0/s1 |
| InChIKey | BFUBVHAQMSXPIB-HNNXBMFYSA-N |
| XLogP | 2.05 |
| TPSA | 86.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.78 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|