C19H18FN7O3 — CID 155520667
(2S)-2-[[3-(4-fluorophenyl)-6,8-dihydro-5H-pyrido[4,3-e][1,2,4]triazin-7-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 155520667) has the molecular formula C19H18FN7O3 and a molecular weight of 411.40 g/mol. Its IUPAC name is (2S)-2-[[3-(4-fluorophenyl)-6,8-dihydro-5H-pyrido[4,3-e][1,2,4]triazin-7-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | (2S)-2-[[3-(4-fluorophenyl)-6,8-dihydro-5H-pyrido[4,3-e][1,2,4]triazin-7-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 155520667 |
| Molecular Formula | C19H18FN7O3 |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (2S)-2-[[3-(4-fluorophenyl)-6,8-dihydro-5H-pyrido[4,3-e][1,2,4]triazin-7-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | C[C@]1(CN2CCc3nc(-c4ccc(F)cc4)nnc3C2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C19H18FN7O3/c1-19(11-26-9-16(27(28)29)22-18(26)30-19)10-25-7-6-14-15(8-25)23-24-17(21-14)12-2-4-13(20)5-3-12/h2-5,9H,6-8,10-11H2,1H3/t19-/m0/s1 |
| InChIKey | WCUJLWLZSPSDCY-IBGZPJMESA-N |
| XLogP | 1.99 |
| TPSA | 112.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|