C18H15F2N5O4 — CID 122460204
(2S)-2-[[2-(3,5-difluorophenyl)-4,6-dihydropyrrolo[3,4-d][1,3]oxazol-5-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 122460204) has the molecular formula C18H15F2N5O4 and a molecular weight of 403.35 g/mol. Its IUPAC name is (2S)-2-[[2-(3,5-difluorophenyl)-4,6-dihydropyrrolo[3,4-d][1,3]oxazol-5-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | (2S)-2-[[2-(3,5-difluorophenyl)-4,6-dihydropyrrolo[3,4-d][1,3]oxazol-5-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 122460204 |
| Molecular Formula | C18H15F2N5O4 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | (2S)-2-[[2-(3,5-difluorophenyl)-4,6-dihydropyrrolo[3,4-d][1,3]oxazol-5-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | C[C@]1(CN2Cc3nc(-c4cc(F)cc(F)c4)oc3C2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C18H15F2N5O4/c1-18(9-24-7-15(25(26)27)22-17(24)29-18)8-23-5-13-14(6-23)28-16(21-13)10-2-11(19)4-12(20)3-10/h2-4,7H,5-6,8-9H2,1H3/t18-/m0/s1 |
| InChIKey | DPZGBPWFKQLWRR-SFHVURJKSA-N |
| XLogP | 2.89 |
| TPSA | 99.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|