C20H19FN6O3 — CID 134587889
2-[[2-(4-fluorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 134587889) has the molecular formula C20H19FN6O3 and a molecular weight of 410.41 g/mol. Its IUPAC name is 2-[[2-(4-fluorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | 2-[[2-(4-fluorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 134587889 |
| Molecular Formula | C20H19FN6O3 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-[[2-(4-fluorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | CC1(CN2CCc3nc(-c4ccc(F)cc4)ncc3C2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C20H19FN6O3/c1-20(12-26-10-17(27(28)29)24-19(26)30-20)11-25-7-6-16-14(9-25)8-22-18(23-16)13-2-4-15(21)5-3-13/h2-5,8,10H,6-7,9,11-12H2,1H3 |
| InChIKey | MMHKPTJFEIYELZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|