C19H19F2N5O4S — CID 158786491
2-(3,4-difluorophenyl)-5-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine;sulfane (PubChem CID 158786491) has the molecular formula C19H19F2N5O4S and a molecular weight of 451.46 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-5-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine;sulfane.
| Compound Name | 2-(3,4-difluorophenyl)-5-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine;sulfane |
|---|---|
| PubChem CID | 158786491 |
| Molecular Formula | C19H19F2N5O4S |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 2-(3,4-difluorophenyl)-5-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridine;sulfane |
| SMILES | C[C@]1(CN2CCc3nc(-c4ccc(F)c(F)c4)oc3C2)Cn2cc([N+](=O)[O-])nc2O1.S |
| InChI | InChI=1S/C19H17F2N5O4.H2S/c1-19(10-25-8-16(26(27)28)23-18(25)30-19)9-24-5-4-14-15(7-24)29-17(22-14)11-2-3-12(20)13(21)6-11;/h2-3,6,8H,4-5,7,9-10H2,1H3;1H2/t19-;/m0./s1 |
| InChIKey | IRTDYKIWFUEVQM-FYZYNONXSA-N |
| XLogP | 3.05 |
| TPSA | 99.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|