C20H18F2N6O3 — CID 122460252
(2S)-2-[[2-(3,5-difluorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 122460252) has the molecular formula C20H18F2N6O3 and a molecular weight of 428.40 g/mol. Its IUPAC name is (2S)-2-[[2-(3,5-difluorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | (2S)-2-[[2-(3,5-difluorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 122460252 |
| Molecular Formula | C20H18F2N6O3 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | (2S)-2-[[2-(3,5-difluorophenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | C[C@]1(CN2CCc3nc(-c4cc(F)cc(F)c4)ncc3C2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C20H18F2N6O3/c1-20(11-27-9-17(28(29)30)25-19(27)31-20)10-26-3-2-16-13(8-26)7-23-18(24-16)12-4-14(21)6-15(22)5-12/h4-7,9H,2-3,8,10-11H2,1H3/t20-/m0/s1 |
| InChIKey | YYVGBGRGFCPOAJ-FQEVSTJZSA-N |
| XLogP | 2.74 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|