C17H26N6O5 — CID 69479855
4-[4-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]piperazin-1-yl]piperidine-1-carboxylic acid (PubChem CID 69479855) has the molecular formula C17H26N6O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 4-[4-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]piperazin-1-yl]piperidine-1-carboxylic acid.
| Compound Name | 4-[4-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]piperazin-1-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69479855 |
| Molecular Formula | C17H26N6O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 4-[4-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]piperazin-1-yl]piperidine-1-carboxylic acid |
| SMILES | C[C@]1(CN2CCN(C3CCN(C(=O)O)CC3)CC2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C17H26N6O5/c1-17(12-22-10-14(23(26)27)18-15(22)28-17)11-19-6-8-20(9-7-19)13-2-4-21(5-3-13)16(24)25/h10,13H,2-9,11-12H2,1H3,(H,24,25)/t17-/m0/s1 |
| InChIKey | QDWBVENRZQAZKL-KRWDZBQOSA-N |
| XLogP | 0.70 |
| TPSA | 117.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|