C22H26F3N5O4 — CID 23081239
1-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]-4-[4-(trifluoromethyl)phenyl]butan-1-one (PubChem CID 23081239) has the molecular formula C22H26F3N5O4 and a molecular weight of 481.48 g/mol. Its IUPAC name is 1-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]-4-[4-(trifluoromethyl)phenyl]butan-1-one.
| Compound Name | 1-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]-4-[4-(trifluoromethyl)phenyl]butan-1-one |
|---|---|
| PubChem CID | 23081239 |
| Molecular Formula | C22H26F3N5O4 |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 1-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]-4-[4-(trifluoromethyl)phenyl]butan-1-one |
| SMILES | CC1(CN2CCN(C(=O)CCCc3ccc(C(F)(F)F)cc3)CC2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C22H26F3N5O4/c1-21(15-29-13-18(30(32)33)26-20(29)34-21)14-27-9-11-28(12-10-27)19(31)4-2-3-16-5-7-17(8-6-16)22(23,24)25/h5-8,13H,2-4,9-12,14-15H2,1H3 |
| InChIKey | AMSISQYGKAJRHO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 93.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|