C19H23N5O5 — CID 89437161
2-benzyl-4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazine-1-carboxylic acid (PubChem CID 89437161) has the molecular formula C19H23N5O5 and a molecular weight of 401.42 g/mol. Its IUPAC name is 2-benzyl-4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazine-1-carboxylic acid.
| Compound Name | 2-benzyl-4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 89437161 |
| Molecular Formula | C19H23N5O5 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 2-benzyl-4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazine-1-carboxylic acid |
| SMILES | CC1(CN2CCN(C(=O)O)C(Cc3ccccc3)C2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C19H23N5O5/c1-19(13-22-11-16(24(27)28)20-17(22)29-19)12-21-7-8-23(18(25)26)15(10-21)9-14-5-3-2-4-6-14/h2-6,11,15H,7-10,12-13H2,1H3,(H,25,26) |
| InChIKey | POVOHCXCNYUYSR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 113.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|