C25H29N5O3 — CID 69480359
2-methyl-6-nitro-2-[2-[4-[(4-phenylphenyl)methyl]piperazin-1-yl]ethyl]-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 69480359) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-methyl-6-nitro-2-[2-[4-[(4-phenylphenyl)methyl]piperazin-1-yl]ethyl]-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | 2-methyl-6-nitro-2-[2-[4-[(4-phenylphenyl)methyl]piperazin-1-yl]ethyl]-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 69480359 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 2-methyl-6-nitro-2-[2-[4-[(4-phenylphenyl)methyl]piperazin-1-yl]ethyl]-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | CC1(CCN2CCN(Cc3ccc(-c4ccccc4)cc3)CC2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C25H29N5O3/c1-25(19-29-18-23(30(31)32)26-24(29)33-25)11-12-27-13-15-28(16-14-27)17-20-7-9-22(10-8-20)21-5-3-2-4-6-21/h2-10,18H,11-17,19H2,1H3 |
| InChIKey | IUMAQGIEUSHMMB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|