C8H11N3O3 — CID 173498527
2-ethyl-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 173498527) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-ethyl-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | 2-ethyl-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 173498527 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 2-ethyl-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | CCC1(C)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C8H11N3O3/c1-3-8(2)5-10-4-6(11(12)13)9-7(10)14-8/h4H,3,5H2,1-2H3 |
| InChIKey | PWJVLFDJBZSZQQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|