C9H15N3O3 — CID 143610880
2,2-dimethyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole;ethane (PubChem CID 143610880) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 2,2-dimethyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole;ethane.
| Compound Name | 2,2-dimethyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole;ethane |
|---|---|
| PubChem CID | 143610880 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 2,2-dimethyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole;ethane |
| SMILES | CC.CC1(C)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C7H9N3O3.C2H6/c1-7(2)4-9-3-5(10(11)12)8-6(9)13-7;1-2/h3H,4H2,1-2H3;1-2H3 |
| InChIKey | GHQOSQSPEWRXNS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|