C25H39N3O4Sn — CID 54771050
tributyl-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]stannane (PubChem CID 54771050) has the molecular formula C25H39N3O4Sn and a molecular weight of 564.32 g/mol. Its IUPAC name is tributyl-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]stannane.
| Compound Name | tributyl-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]stannane |
|---|---|
| PubChem CID | 54771050 |
| Molecular Formula | C25H39N3O4Sn |
| Molecular Weight | 564.32 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | tributyl-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(OC[C@@]2(C)Cn3cc([N+](=O)[O-])nc3O2)cc1 |
| InChI | InChI=1S/C13H12N3O4.3C4H9.Sn/c1-13(9-19-10-5-3-2-4-6-10)8-15-7-11(16(17)18)14-12(15)20-13;3*1-3-4-2;/h3-7H,8-9H2,1H3;3*1,3-4H2,2H3;/t13-;;;;/m1..../s1 |
| InChIKey | VJAUPMGIBVSJFC-SVZPRBGCSA-N |
| XLogP | 6.08 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.32 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|