C21H24N4O5 — CID 122484663
(2R)-2-methyl-6-nitro-2-[[4-(5-pentyl-1,2-oxazol-3-yl)phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 122484663) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is (2R)-2-methyl-6-nitro-2-[[4-(5-pentyl-1,2-oxazol-3-yl)phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | (2R)-2-methyl-6-nitro-2-[[4-(5-pentyl-1,2-oxazol-3-yl)phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 122484663 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (2R)-2-methyl-6-nitro-2-[[4-(5-pentyl-1,2-oxazol-3-yl)phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | CCCCCc1cc(-c2ccc(OC[C@@]3(C)Cn4cc([N+](=O)[O-])nc4O3)cc2)no1 |
| InChI | InChI=1S/C21H24N4O5/c1-3-4-5-6-17-11-18(23-30-17)15-7-9-16(10-8-15)28-14-21(2)13-24-12-19(25(26)27)22-20(24)29-21/h7-12H,3-6,13-14H2,1-2H3/t21-/m1/s1 |
| InChIKey | VKKSJRMVSYPZFC-OAQYLSRUSA-N |
| XLogP | 4.41 |
| TPSA | 105.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|