C19H21F3N4O5 — CID 10094880
2-methyl-6-nitro-2-[[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]methyl]-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 10094880) has the molecular formula C19H21F3N4O5 and a molecular weight of 442.39 g/mol. Its IUPAC name is 2-methyl-6-nitro-2-[[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]methyl]-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | 2-methyl-6-nitro-2-[[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 10094880 |
| Molecular Formula | C19H21F3N4O5 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 2-methyl-6-nitro-2-[[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | CC1(CN2CCC(Oc3ccc(OC(F)(F)F)cc3)CC2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C19H21F3N4O5/c1-18(12-25-10-16(26(27)28)23-17(25)31-18)11-24-8-6-14(7-9-24)29-13-2-4-15(5-3-13)30-19(20,21)22/h2-5,10,14H,6-9,11-12H2,1H3 |
| InChIKey | LXWLEHKPRBDYGL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 91.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|