C22H28F3N5O4 — CID 69481325
N-methyl-N-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]-2-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]ethanamine (PubChem CID 69481325) has the molecular formula C22H28F3N5O4 and a molecular weight of 483.49 g/mol. Its IUPAC name is N-methyl-N-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]-2-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]ethanamine.
| Compound Name | N-methyl-N-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]-2-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]ethanamine |
|---|---|
| PubChem CID | 69481325 |
| Molecular Formula | C22H28F3N5O4 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | N-methyl-N-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]-2-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]ethanamine |
| SMILES | CN(CCN1CCC(Oc2ccc(C(F)(F)F)cc2)CC1)C[C@@]1(C)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C22H28F3N5O4/c1-21(15-29-13-19(30(31)32)26-20(29)34-21)14-27(2)11-12-28-9-7-18(8-10-28)33-17-5-3-16(4-6-17)22(23,24)25/h3-6,13,18H,7-12,14-15H2,1-2H3/t21-/m0/s1 |
| InChIKey | JQSRFJZLJCXMDJ-NRFANRHFSA-N |
| XLogP | 3.44 |
| TPSA | 85.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|