C18H18ClN5O3S2 — CID 158750820
(2S)-2-[[2-(4-chlorophenyl)-4,6-dihydropyrrolo[3,4-d][1,3]thiazol-5-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole;sulfane (PubChem CID 158750820) has the molecular formula C18H18ClN5O3S2 and a molecular weight of 451.96 g/mol. Its IUPAC name is (2S)-2-[[2-(4-chlorophenyl)-4,6-dihydropyrrolo[3,4-d][1,3]thiazol-5-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole;sulfane.
| Compound Name | (2S)-2-[[2-(4-chlorophenyl)-4,6-dihydropyrrolo[3,4-d][1,3]thiazol-5-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole;sulfane |
|---|---|
| PubChem CID | 158750820 |
| Molecular Formula | C18H18ClN5O3S2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | (2S)-2-[[2-(4-chlorophenyl)-4,6-dihydropyrrolo[3,4-d][1,3]thiazol-5-yl]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole;sulfane |
| SMILES | C[C@]1(CN2Cc3nc(-c4ccc(Cl)cc4)sc3C2)Cn2cc([N+](=O)[O-])nc2O1.S |
| InChI | InChI=1S/C18H16ClN5O3S.H2S/c1-18(10-23-8-15(24(25)26)21-17(23)27-18)9-22-6-13-14(7-22)28-16(20-13)11-2-4-12(19)5-3-11;/h2-5,8H,6-7,9-10H2,1H3;1H2/t18-;/m0./s1 |
| InChIKey | INLMZMQANCTPIJ-FERBBOLQSA-N |
| XLogP | 3.85 |
| TPSA | 86.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|