C17H16ClN5O5 — CID 69479515
5-[2-(4-chlorophenyl)ethyl]-3-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]-1,3,4-oxadiazol-2-one (PubChem CID 69479515) has the molecular formula C17H16ClN5O5 and a molecular weight of 405.80 g/mol. Its IUPAC name is 5-[2-(4-chlorophenyl)ethyl]-3-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]-1,3,4-oxadiazol-2-one.
| Compound Name | 5-[2-(4-chlorophenyl)ethyl]-3-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 69479515 |
| Molecular Formula | C17H16ClN5O5 |
| Molecular Weight | 405.80 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 5-[2-(4-chlorophenyl)ethyl]-3-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]-1,3,4-oxadiazol-2-one |
| SMILES | CC1(Cn2nc(CCc3ccc(Cl)cc3)oc2=O)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C17H16ClN5O5/c1-17(9-21-8-13(23(25)26)19-15(21)28-17)10-22-16(24)27-14(20-22)7-4-11-2-5-12(18)6-3-11/h2-3,5-6,8H,4,7,9-10H2,1H3 |
| InChIKey | WTMYEHREPQCNNU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 118.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.80 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|