C20H21ClN6O4 — CID 69480120
1-(5-chloro-1-benzofuran-2-yl)-N-[4-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]piperazin-1-yl]methanimine (PubChem CID 69480120) has the molecular formula C20H21ClN6O4 and a molecular weight of 444.88 g/mol. Its IUPAC name is 1-(5-chloro-1-benzofuran-2-yl)-N-[4-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]piperazin-1-yl]methanimine.
| Compound Name | 1-(5-chloro-1-benzofuran-2-yl)-N-[4-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]piperazin-1-yl]methanimine |
|---|---|
| PubChem CID | 69480120 |
| Molecular Formula | C20H21ClN6O4 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 1-(5-chloro-1-benzofuran-2-yl)-N-[4-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]piperazin-1-yl]methanimine |
| SMILES | C[C@]1(CN2CCN(N=Cc3cc4cc(Cl)ccc4o3)CC2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C20H21ClN6O4/c1-20(13-25-11-18(27(28)29)23-19(25)31-20)12-24-4-6-26(7-5-24)22-10-16-9-14-8-15(21)2-3-17(14)30-16/h2-3,8-11H,4-7,12-13H2,1H3/t20-/m0/s1 |
| InChIKey | GCLWAJFSWVDEOD-FQEVSTJZSA-N |
| XLogP | 2.99 |
| TPSA | 102.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|