C33H34F3N5O6 — CID 70874578
7-methyl-2-nitro-7-[[4-[4-[[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methyl]piperazin-1-yl]phenoxy]methyl]-5,6-dihydroimidazo[2,1-b][1,3]oxazine (PubChem CID 70874578) has the molecular formula C33H34F3N5O6 and a molecular weight of 653.66 g/mol. Its IUPAC name is 7-methyl-2-nitro-7-[[4-[4-[[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methyl]piperazin-1-yl]phenoxy]methyl]-5,6-dihydroimidazo[2,1-b][1,3]oxazine.
| Compound Name | 7-methyl-2-nitro-7-[[4-[4-[[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methyl]piperazin-1-yl]phenoxy]methyl]-5,6-dihydroimidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 70874578 |
| Molecular Formula | C33H34F3N5O6 |
| Molecular Weight | 653.66 g/mol |
| Exact Mass | 653.25 |
| IUPAC Name | 7-methyl-2-nitro-7-[[4-[4-[[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methyl]piperazin-1-yl]phenoxy]methyl]-5,6-dihydroimidazo[2,1-b][1,3]oxazine |
| SMILES | CC1(COc2ccc(N3CCN(Cc4ccc(OCc5ccc(OC(F)(F)F)cc5)cc4)CC3)cc2)CCn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C33H34F3N5O6/c1-32(14-15-40-21-30(41(42)43)37-31(40)47-32)23-45-28-12-6-26(7-13-28)39-18-16-38(17-19-39)20-24-2-8-27(9-3-24)44-22-25-4-10-29(11-5-25)46-33(34,35)36/h2-13,21H,14-20,22-23H2,1H3 |
| InChIKey | YTADABQNYJADIC-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 104.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.66 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|