C16H16F3N3O5 — CID 50914227
7-methyl-2-nitro-7-[[3-(trifluoromethoxy)phenyl]methoxymethyl]-5,6-dihydroimidazo[2,1-b][1,3]oxazine (PubChem CID 50914227) has the molecular formula C16H16F3N3O5 and a molecular weight of 387.31 g/mol. Its IUPAC name is 7-methyl-2-nitro-7-[[3-(trifluoromethoxy)phenyl]methoxymethyl]-5,6-dihydroimidazo[2,1-b][1,3]oxazine.
| Compound Name | 7-methyl-2-nitro-7-[[3-(trifluoromethoxy)phenyl]methoxymethyl]-5,6-dihydroimidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 50914227 |
| Molecular Formula | C16H16F3N3O5 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 7-methyl-2-nitro-7-[[3-(trifluoromethoxy)phenyl]methoxymethyl]-5,6-dihydroimidazo[2,1-b][1,3]oxazine |
| SMILES | CC1(COCc2cccc(OC(F)(F)F)c2)CCn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C16H16F3N3O5/c1-15(5-6-21-8-13(22(23)24)20-14(21)27-15)10-25-9-11-3-2-4-12(7-11)26-16(17,18)19/h2-4,7-8H,5-6,9-10H2,1H3 |
| InChIKey | SPAYDMYBDJTUPR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 88.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|