C26H25F3N6O5S — CID 5278835
(2R)-2-methyl-6-nitro-2-[[2-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-6-yl]oxymethyl]-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 5278835) has the molecular formula C26H25F3N6O5S and a molecular weight of 590.58 g/mol. Its IUPAC name is (2R)-2-methyl-6-nitro-2-[[2-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-6-yl]oxymethyl]-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | (2R)-2-methyl-6-nitro-2-[[2-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-6-yl]oxymethyl]-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 5278835 |
| Molecular Formula | C26H25F3N6O5S |
| Molecular Weight | 590.58 g/mol |
| Exact Mass | 590.16 |
| IUPAC Name | (2R)-2-methyl-6-nitro-2-[[2-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazol-6-yl]oxymethyl]-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | C[C@]1(COc2ccc3nc(N4CCN(Cc5ccc(OC(F)(F)F)cc5)CC4)sc3c2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C26H25F3N6O5S/c1-25(15-34-14-22(35(36)37)31-23(34)40-25)16-38-19-6-7-20-21(12-19)41-24(30-20)33-10-8-32(9-11-33)13-17-2-4-18(5-3-17)39-26(27,28)29/h2-7,12,14H,8-11,13,15-16H2,1H3/t25-/m1/s1 |
| InChIKey | SKTYPRXUSTZKLI-RUZDIDTESA-N |
| XLogP | 4.85 |
| TPSA | 108.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|