C29H26F3N5O5 — CID 67274255
(2S)-2-methyl-6-nitro-2-[[2-[4-[[4-(trifluoromethoxy)phenyl]methylidene]piperidin-1-yl]quinolin-6-yl]oxymethyl]-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 67274255) has the molecular formula C29H26F3N5O5 and a molecular weight of 581.55 g/mol. Its IUPAC name is (2S)-2-methyl-6-nitro-2-[[2-[4-[[4-(trifluoromethoxy)phenyl]methylidene]piperidin-1-yl]quinolin-6-yl]oxymethyl]-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | (2S)-2-methyl-6-nitro-2-[[2-[4-[[4-(trifluoromethoxy)phenyl]methylidene]piperidin-1-yl]quinolin-6-yl]oxymethyl]-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 67274255 |
| Molecular Formula | C29H26F3N5O5 |
| Molecular Weight | 581.55 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | (2S)-2-methyl-6-nitro-2-[[2-[4-[[4-(trifluoromethoxy)phenyl]methylidene]piperidin-1-yl]quinolin-6-yl]oxymethyl]-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | C[C@@]1(COc2ccc3nc(N4CCC(=Cc5ccc(OC(F)(F)F)cc5)CC4)ccc3c2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C29H26F3N5O5/c1-28(17-36-16-26(37(38)39)34-27(36)42-28)18-40-23-7-8-24-21(15-23)4-9-25(33-24)35-12-10-20(11-13-35)14-19-2-5-22(6-3-19)41-29(30,31)32/h2-9,14-16H,10-13,17-18H2,1H3/t28-/m0/s1 |
| InChIKey | KGNGJXKCDSSZML-NDEPHWFRSA-N |
| XLogP | 6.15 |
| TPSA | 104.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|