C24H19F3N4O6 — CID 70874823
2-nitro-7-[[2-[[4-(trifluoromethoxy)phenyl]methoxy]quinolin-6-yl]oxymethyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 70874823) has the molecular formula C24H19F3N4O6 and a molecular weight of 516.43 g/mol. Its IUPAC name is 2-nitro-7-[[2-[[4-(trifluoromethoxy)phenyl]methoxy]quinolin-6-yl]oxymethyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | 2-nitro-7-[[2-[[4-(trifluoromethoxy)phenyl]methoxy]quinolin-6-yl]oxymethyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 70874823 |
| Molecular Formula | C24H19F3N4O6 |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 2-nitro-7-[[2-[[4-(trifluoromethoxy)phenyl]methoxy]quinolin-6-yl]oxymethyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC(COc1ccc3nc(OCc4ccc(OC(F)(F)F)cc4)ccc3c1)CC2 |
| InChI | InChI=1S/C24H19F3N4O6/c25-24(26,27)37-17-4-1-15(2-5-17)13-35-22-8-3-16-11-18(6-7-20(16)28-22)34-14-19-9-10-30-12-21(31(32)33)29-23(30)36-19/h1-8,11-12,19H,9-10,13-14H2 |
| InChIKey | RHOPXRDSDRPILC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 110.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|