C27H29F3N4O5 — CID 11466929
(2S)-6-nitro-2-[[4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]phenoxy]methyl]-2,3-dihydroimidazo[2,1-b][1,3]oxazole (PubChem CID 11466929) has the molecular formula C27H29F3N4O5 and a molecular weight of 546.55 g/mol. Its IUPAC name is (2S)-6-nitro-2-[[4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]phenoxy]methyl]-2,3-dihydroimidazo[2,1-b][1,3]oxazole.
| Compound Name | (2S)-6-nitro-2-[[4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]phenoxy]methyl]-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 11466929 |
| Molecular Formula | C27H29F3N4O5 |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | (2S)-6-nitro-2-[[4-[4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidin-1-yl]phenoxy]methyl]-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
| SMILES | O=[N+]([O-])c1cn2c(n1)O[C@H](COc1ccc(N3CCC(CCCc4ccc(OC(F)(F)F)cc4)CC3)cc1)C2 |
| InChI | InChI=1S/C27H29F3N4O5/c28-27(29,30)39-23-8-4-19(5-9-23)2-1-3-20-12-14-32(15-13-20)21-6-10-22(11-7-21)37-18-24-16-33-17-25(34(35)36)31-26(33)38-24/h4-11,17,20,24H,1-3,12-16,18H2/t24-/m0/s1 |
| InChIKey | CIPSUSFFWITBFU-DEOSSOPVSA-N |
| XLogP | 5.77 |
| TPSA | 91.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|