C14H12F3N3O5 — CID 50914370
(6R)-2-nitro-6-[[4-(trifluoromethoxy)phenoxy]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 50914370) has the molecular formula C14H12F3N3O5 and a molecular weight of 359.26 g/mol. Its IUPAC name is (6R)-2-nitro-6-[[4-(trifluoromethoxy)phenoxy]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | (6R)-2-nitro-6-[[4-(trifluoromethoxy)phenoxy]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 50914370 |
| Molecular Formula | C14H12F3N3O5 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | (6R)-2-nitro-6-[[4-(trifluoromethoxy)phenoxy]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC[C@@H](COc1ccc(OC(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C14H12F3N3O5/c15-14(16,17)25-11-3-1-10(2-4-11)23-7-9-5-19-6-12(20(21)22)18-13(19)24-8-9/h1-4,6,9H,5,7-8H2/t9-/m1/s1 |
| InChIKey | YMBWFCMEEHOGSZ-SECBINFHSA-N |
| XLogP | 2.78 |
| TPSA | 88.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|