C20H19F3N6O5 — CID 156889566
N-methyl-N-[2-methyl-4-(trifluoromethoxy)phenyl]-5-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]oxymethyl]pyrimidin-2-amine (PubChem CID 156889566) has the molecular formula C20H19F3N6O5 and a molecular weight of 480.40 g/mol. Its IUPAC name is N-methyl-N-[2-methyl-4-(trifluoromethoxy)phenyl]-5-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]oxymethyl]pyrimidin-2-amine.
| Compound Name | N-methyl-N-[2-methyl-4-(trifluoromethoxy)phenyl]-5-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]oxymethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 156889566 |
| Molecular Formula | C20H19F3N6O5 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | N-methyl-N-[2-methyl-4-(trifluoromethoxy)phenyl]-5-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]oxymethyl]pyrimidin-2-amine |
| SMILES | Cc1cc(OC(F)(F)F)ccc1N(C)c1ncc(CO[C@@H]2COc3nc([N+](=O)[O-])cn3C2)cn1 |
| InChI | InChI=1S/C20H19F3N6O5/c1-12-5-14(34-20(21,22)23)3-4-16(12)27(2)18-24-6-13(7-25-18)10-32-15-8-28-9-17(29(30)31)26-19(28)33-11-15/h3-7,9,15H,8,10-11H2,1-2H3/t15-/m0/s1 |
| InChIKey | IVSJHBWXXNVIQV-HNNXBMFYSA-N |
| XLogP | 3.53 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|