C21H15F3N4O5 — CID 50916526
(6S)-2-nitro-6-[[5-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-2-pyridinyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 50916526) has the molecular formula C21H15F3N4O5 and a molecular weight of 460.37 g/mol. Its IUPAC name is (6S)-2-nitro-6-[[5-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-2-pyridinyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | (6S)-2-nitro-6-[[5-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-2-pyridinyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 50916526 |
| Molecular Formula | C21H15F3N4O5 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | (6S)-2-nitro-6-[[5-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-2-pyridinyl]methoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC[C@@H](OCc1ccc(C#Cc3ccc(OC(F)(F)F)cc3)cn1)C2 |
| InChI | InChI=1S/C21H15F3N4O5/c22-21(23,24)33-17-7-4-14(5-8-17)1-2-15-3-6-16(25-9-15)12-31-18-10-27-11-19(28(29)30)26-20(27)32-13-18/h3-9,11,18H,10,12-13H2/t18-/m0/s1 |
| InChIKey | IMAWBGLPMIBFHZ-SFHVURJKSA-N |
| XLogP | 3.46 |
| TPSA | 101.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|