C25H26F3N7O4 — CID 121404761
(6S)-2-nitro-N-[[6-[2-[4-(trifluoromethoxy)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-pyridinyl]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine (PubChem CID 121404761) has the molecular formula C25H26F3N7O4 and a molecular weight of 545.52 g/mol. Its IUPAC name is (6S)-2-nitro-N-[[6-[2-[4-(trifluoromethoxy)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-pyridinyl]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine.
| Compound Name | (6S)-2-nitro-N-[[6-[2-[4-(trifluoromethoxy)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-pyridinyl]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine |
|---|---|
| PubChem CID | 121404761 |
| Molecular Formula | C25H26F3N7O4 |
| Molecular Weight | 545.52 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | (6S)-2-nitro-N-[[6-[2-[4-(trifluoromethoxy)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-pyridinyl]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC[C@@H](NCc1ccc(N3CC4CN(c5ccc(OC(F)(F)F)cc5)CC4C3)nc1)C2 |
| InChI | InChI=1S/C25H26F3N7O4/c26-25(27,28)39-21-4-2-20(3-5-21)32-9-17-11-33(12-18(17)10-32)22-6-1-16(8-30-22)7-29-19-13-34-14-23(35(36)37)31-24(34)38-15-19/h1-6,8,14,17-19,29H,7,9-13,15H2/t17?,18?,19-/m0/s1 |
| InChIKey | NBBIXYVZCUMRLX-ACBHZAAOSA-N |
| XLogP | 3.21 |
| TPSA | 110.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|