C15H13F3N4O5 — CID 71593178
N-(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl)-2-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 71593178) has the molecular formula C15H13F3N4O5 and a molecular weight of 386.29 g/mol. Its IUPAC name is N-(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl)-2-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl)-2-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 71593178 |
| Molecular Formula | C15H13F3N4O5 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N-(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl)-2-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(OC(F)(F)F)cc1)NC1COc2nc([N+](=O)[O-])cn2C1 |
| InChI | InChI=1S/C15H13F3N4O5/c16-15(17,18)27-11-3-1-9(2-4-11)5-13(23)19-10-6-21-7-12(22(24)25)20-14(21)26-8-10/h1-4,7,10H,5-6,8H2,(H,19,23) |
| InChIKey | IIOPDVZVWXUZCY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|