C21H16ClF3N4O5 — CID 53466260
2-chloro-N-[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide (PubChem CID 53466260) has the molecular formula C21H16ClF3N4O5 and a molecular weight of 496.83 g/mol. Its IUPAC name is 2-chloro-N-[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide.
| Compound Name | 2-chloro-N-[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 53466260 |
| Molecular Formula | C21H16ClF3N4O5 |
| Molecular Weight | 496.83 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | 2-chloro-N-[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]-N-[[4-(trifluoromethoxy)phenyl]methyl]benzamide |
| SMILES | O=C(c1ccccc1Cl)N(Cc1ccc(OC(F)(F)F)cc1)[C@@H]1COc2nc([N+](=O)[O-])cn2C1 |
| InChI | InChI=1S/C21H16ClF3N4O5/c22-17-4-2-1-3-16(17)19(30)28(9-13-5-7-15(8-6-13)34-21(23,24)25)14-10-27-11-18(29(31)32)26-20(27)33-12-14/h1-8,11,14H,9-10,12H2/t14-/m0/s1 |
| InChIKey | CBXUWGSELJZMFC-AWEZNQCLSA-N |
| XLogP | 4.45 |
| TPSA | 99.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.83 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|