C16H17F3N4O4 — CID 53327586
(6S,7S)-7-ethyl-2-nitro-N-[[4-(trifluoromethoxy)phenyl]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine (PubChem CID 53327586) has the molecular formula C16H17F3N4O4 and a molecular weight of 386.33 g/mol. Its IUPAC name is (6S,7S)-7-ethyl-2-nitro-N-[[4-(trifluoromethoxy)phenyl]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine.
| Compound Name | (6S,7S)-7-ethyl-2-nitro-N-[[4-(trifluoromethoxy)phenyl]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine |
|---|---|
| PubChem CID | 53327586 |
| Molecular Formula | C16H17F3N4O4 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | (6S,7S)-7-ethyl-2-nitro-N-[[4-(trifluoromethoxy)phenyl]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine |
| SMILES | CC[C@@H]1Oc2nc([N+](=O)[O-])cn2C[C@@H]1NCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H17F3N4O4/c1-2-13-12(8-22-9-14(23(24)25)21-15(22)26-13)20-7-10-3-5-11(6-4-10)27-16(17,18)19/h3-6,9,12-13,20H,2,7-8H2,1H3/t12-,13-/m0/s1 |
| InChIKey | QUMQKEVIGLONFT-STQMWFEESA-N |
| XLogP | 3.02 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|