C23H23F3N6O5 — CID 121404847
(6S)-2-nitro-N-[[6-[3-[4-(trifluoromethoxy)phenoxy]pyrrolidin-1-yl]-3-pyridinyl]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine (PubChem CID 121404847) has the molecular formula C23H23F3N6O5 and a molecular weight of 520.47 g/mol. Its IUPAC name is (6S)-2-nitro-N-[[6-[3-[4-(trifluoromethoxy)phenoxy]pyrrolidin-1-yl]-3-pyridinyl]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine.
| Compound Name | (6S)-2-nitro-N-[[6-[3-[4-(trifluoromethoxy)phenoxy]pyrrolidin-1-yl]-3-pyridinyl]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine |
|---|---|
| PubChem CID | 121404847 |
| Molecular Formula | C23H23F3N6O5 |
| Molecular Weight | 520.47 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | (6S)-2-nitro-N-[[6-[3-[4-(trifluoromethoxy)phenoxy]pyrrolidin-1-yl]-3-pyridinyl]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC[C@@H](NCc1ccc(N3CCC(Oc4ccc(OC(F)(F)F)cc4)C3)nc1)C2 |
| InChI | InChI=1S/C23H23F3N6O5/c24-23(25,26)37-18-4-2-17(3-5-18)36-19-7-8-30(12-19)20-6-1-15(10-28-20)9-27-16-11-31-13-21(32(33)34)29-22(31)35-14-16/h1-6,10,13,16,19,27H,7-9,11-12,14H2/t16-,19?/m0/s1 |
| InChIKey | YEJGNXWZHCNEBO-UCFFOFKASA-N |
| XLogP | 3.29 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|