C17H18F2N4O5 — CID 86342023
(6S)-N-[[2-cyclopropyloxy-4-(difluoromethoxy)phenyl]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine (PubChem CID 86342023) has the molecular formula C17H18F2N4O5 and a molecular weight of 396.35 g/mol. Its IUPAC name is (6S)-N-[[2-cyclopropyloxy-4-(difluoromethoxy)phenyl]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine.
| Compound Name | (6S)-N-[[2-cyclopropyloxy-4-(difluoromethoxy)phenyl]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine |
|---|---|
| PubChem CID | 86342023 |
| Molecular Formula | C17H18F2N4O5 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | (6S)-N-[[2-cyclopropyloxy-4-(difluoromethoxy)phenyl]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC[C@@H](NCc1ccc(OC(F)F)cc1OC1CC1)C2 |
| InChI | InChI=1S/C17H18F2N4O5/c18-16(19)28-13-2-1-10(14(5-13)27-12-3-4-12)6-20-11-7-22-8-15(23(24)25)21-17(22)26-9-11/h1-2,5,8,11-12,16,20H,3-4,6-7,9H2/t11-/m0/s1 |
| InChIKey | LUDTWPOFEJZBAV-NSHDSACASA-N |
| XLogP | 2.48 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|