C22H25FN8O3 — CID 121404814
(6S)-N-[[2-[4-(4-fluoro-3-methylphenyl)piperazin-1-yl]pyrimidin-5-yl]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine (PubChem CID 121404814) has the molecular formula C22H25FN8O3 and a molecular weight of 468.49 g/mol. Its IUPAC name is (6S)-N-[[2-[4-(4-fluoro-3-methylphenyl)piperazin-1-yl]pyrimidin-5-yl]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine.
| Compound Name | (6S)-N-[[2-[4-(4-fluoro-3-methylphenyl)piperazin-1-yl]pyrimidin-5-yl]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine |
|---|---|
| PubChem CID | 121404814 |
| Molecular Formula | C22H25FN8O3 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | (6S)-N-[[2-[4-(4-fluoro-3-methylphenyl)piperazin-1-yl]pyrimidin-5-yl]methyl]-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-amine |
| SMILES | Cc1cc(N2CCN(c3ncc(CN[C@@H]4COc5nc([N+](=O)[O-])cn5C4)cn3)CC2)ccc1F |
| InChI | InChI=1S/C22H25FN8O3/c1-15-8-18(2-3-19(15)23)28-4-6-29(7-5-28)21-25-10-16(11-26-21)9-24-17-12-30-13-20(31(32)33)27-22(30)34-14-17/h2-3,8,10-11,13,17,24H,4-7,9,12,14H2,1H3/t17-/m0/s1 |
| InChIKey | AZHAXAQXDZFGIG-KRWDZBQOSA-N |
| XLogP | 1.91 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|