C21H24F3NO — CID 141113382
1-phenyl-4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidine (PubChem CID 141113382) has the molecular formula C21H24F3NO and a molecular weight of 363.42 g/mol. Its IUPAC name is 1-phenyl-4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidine.
| Compound Name | 1-phenyl-4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidine |
|---|---|
| PubChem CID | 141113382 |
| Molecular Formula | C21H24F3NO |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-phenyl-4-[3-[4-(trifluoromethoxy)phenyl]propyl]piperidine |
| SMILES | FC(F)(F)Oc1ccc(CCCC2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H24F3NO/c22-21(23,24)26-20-11-9-17(10-12-20)5-4-6-18-13-15-25(16-14-18)19-7-2-1-3-8-19/h1-3,7-12,18H,4-6,13-16H2 |
| InChIKey | AWCQHEMNSJMTLR-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |