C25H29F3N2OS — CID 174498448
4-[4-[6-[4-(trifluoromethoxy)phenyl]hexyl]piperidin-1-yl]-1,3-benzothiazole (PubChem CID 174498448) has the molecular formula C25H29F3N2OS and a molecular weight of 462.58 g/mol. Its IUPAC name is 4-[4-[6-[4-(trifluoromethoxy)phenyl]hexyl]piperidin-1-yl]-1,3-benzothiazole.
| Compound Name | 4-[4-[6-[4-(trifluoromethoxy)phenyl]hexyl]piperidin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 174498448 |
| Molecular Formula | C25H29F3N2OS |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 4-[4-[6-[4-(trifluoromethoxy)phenyl]hexyl]piperidin-1-yl]-1,3-benzothiazole |
| SMILES | FC(F)(F)Oc1ccc(CCCCCCC2CCN(c3cccc4scnc34)CC2)cc1 |
| InChI | InChI=1S/C25H29F3N2OS/c26-25(27,28)31-21-12-10-19(11-13-21)6-3-1-2-4-7-20-14-16-30(17-15-20)22-8-5-9-23-24(22)29-18-32-23/h5,8-13,18,20H,1-4,6-7,14-17H2 |
| InChIKey | KHKACGHQDZNZDG-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|