C22H21F3N2O2 — CID 136653792
6-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-1-yl]quinolin-5-ol (PubChem CID 136653792) has the molecular formula C22H21F3N2O2 and a molecular weight of 402.42 g/mol. Its IUPAC name is 6-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-1-yl]quinolin-5-ol.
| Compound Name | 6-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-1-yl]quinolin-5-ol |
|---|---|
| PubChem CID | 136653792 |
| Molecular Formula | C22H21F3N2O2 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 6-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-1-yl]quinolin-5-ol |
| SMILES | Oc1c(N2CCC(Cc3ccc(OC(F)(F)F)cc3)CC2)ccc2ncccc12 |
| InChI | InChI=1S/C22H21F3N2O2/c23-22(24,25)29-17-5-3-15(4-6-17)14-16-9-12-27(13-10-16)20-8-7-19-18(21(20)28)2-1-11-26-19/h1-8,11,16,28H,9-10,12-14H2 |
| InChIKey | GFNBBPXLAFRBPX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |