C14H18F3NO — CID 64505434
N-methyl-3-[[4-(trifluoromethoxy)phenyl]methyl]cyclopentan-1-amine (PubChem CID 64505434) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is N-methyl-3-[[4-(trifluoromethoxy)phenyl]methyl]cyclopentan-1-amine.
| Compound Name | N-methyl-3-[[4-(trifluoromethoxy)phenyl]methyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 64505434 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-methyl-3-[[4-(trifluoromethoxy)phenyl]methyl]cyclopentan-1-amine |
| SMILES | CNC1CCC(Cc2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C14H18F3NO/c1-18-12-5-2-11(9-12)8-10-3-6-13(7-4-10)19-14(15,16)17/h3-4,6-7,11-12,18H,2,5,8-9H2,1H3 |
| InChIKey | DUSMCBVIYKDUHH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |