C14H18F3NO3S — CID 167819810
1-(2-methylsulfonylethyl)-3-[[4-(trifluoromethoxy)phenyl]methyl]azetidine (PubChem CID 167819810) has the molecular formula C14H18F3NO3S and a molecular weight of 337.36 g/mol. Its IUPAC name is 1-(2-methylsulfonylethyl)-3-[[4-(trifluoromethoxy)phenyl]methyl]azetidine.
| Compound Name | 1-(2-methylsulfonylethyl)-3-[[4-(trifluoromethoxy)phenyl]methyl]azetidine |
|---|---|
| PubChem CID | 167819810 |
| Molecular Formula | C14H18F3NO3S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 1-(2-methylsulfonylethyl)-3-[[4-(trifluoromethoxy)phenyl]methyl]azetidine |
| SMILES | CS(=O)(=O)CCN1CC(Cc2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C14H18F3NO3S/c1-22(19,20)7-6-18-9-12(10-18)8-11-2-4-13(5-3-11)21-14(15,16)17/h2-5,12H,6-10H2,1H3 |
| InChIKey | HRHOQULSRBPMLF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |