C12H15F3O4S — CID 65148112
4-methylsulfonyl-1-[4-(trifluoromethoxy)phenyl]butan-1-ol (PubChem CID 65148112) has the molecular formula C12H15F3O4S and a molecular weight of 312.31 g/mol. Its IUPAC name is 4-methylsulfonyl-1-[4-(trifluoromethoxy)phenyl]butan-1-ol.
| Compound Name | 4-methylsulfonyl-1-[4-(trifluoromethoxy)phenyl]butan-1-ol |
|---|---|
| PubChem CID | 65148112 |
| Molecular Formula | C12H15F3O4S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 4-methylsulfonyl-1-[4-(trifluoromethoxy)phenyl]butan-1-ol |
| SMILES | CS(=O)(=O)CCCC(O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3O4S/c1-20(17,18)8-2-3-11(16)9-4-6-10(7-5-9)19-12(13,14)15/h4-7,11,16H,2-3,8H2,1H3 |
| InChIKey | BLDSAWDEMVDZIG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |