C17H20O3S — CID 65148469
4-methylsulfonyl-1-(4-phenylphenyl)butan-1-ol (PubChem CID 65148469) has the molecular formula C17H20O3S and a molecular weight of 304.41 g/mol. Its IUPAC name is 4-methylsulfonyl-1-(4-phenylphenyl)butan-1-ol.
| Compound Name | 4-methylsulfonyl-1-(4-phenylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 65148469 |
| Molecular Formula | C17H20O3S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-methylsulfonyl-1-(4-phenylphenyl)butan-1-ol |
| SMILES | CS(=O)(=O)CCCC(O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H20O3S/c1-21(19,20)13-5-8-17(18)16-11-9-15(10-12-16)14-6-3-2-4-7-14/h2-4,6-7,9-12,17-18H,5,8,13H2,1H3 |
| InChIKey | YZMIOBYAMVWGMA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |