C12H19NO3S — CID 93451131
(1S)-2-(3-methylsulfonylpropylamino)-1-phenylethanol (PubChem CID 93451131) has the molecular formula C12H19NO3S and a molecular weight of 257.36 g/mol. Its IUPAC name is (1S)-2-(3-methylsulfonylpropylamino)-1-phenylethanol.
| Compound Name | (1S)-2-(3-methylsulfonylpropylamino)-1-phenylethanol |
|---|---|
| PubChem CID | 93451131 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (1S)-2-(3-methylsulfonylpropylamino)-1-phenylethanol |
| SMILES | CS(=O)(=O)CCCNC[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C12H19NO3S/c1-17(15,16)9-5-8-13-10-12(14)11-6-3-2-4-7-11/h2-4,6-7,12-14H,5,8-10H2,1H3/t12-/m1/s1 |
| InChIKey | IFBMPBNGLFHMPL-GFCCVEGCSA-N |
| XLogP | 0.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|