C11H16BrNO3S — CID 54935167
1-(3-bromophenyl)-2-(2-methylsulfonylethylamino)ethanol (PubChem CID 54935167) has the molecular formula C11H16BrNO3S and a molecular weight of 322.22 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(2-methylsulfonylethylamino)ethanol.
| Compound Name | 1-(3-bromophenyl)-2-(2-methylsulfonylethylamino)ethanol |
|---|---|
| PubChem CID | 54935167 |
| Molecular Formula | C11H16BrNO3S |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 1-(3-bromophenyl)-2-(2-methylsulfonylethylamino)ethanol |
| SMILES | CS(=O)(=O)CCNCC(O)c1cccc(Br)c1 |
| InChI | InChI=1S/C11H16BrNO3S/c1-17(15,16)6-5-13-8-11(14)9-3-2-4-10(12)7-9/h2-4,7,11,13-14H,5-6,8H2,1H3 |
| InChIKey | OIAPYCDHYBXJLR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|