C17H20BrNO2 — CID 62380958
1-(3-bromophenyl)-2-(3-phenoxypropylamino)ethanol (PubChem CID 62380958) has the molecular formula C17H20BrNO2 and a molecular weight of 350.26 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(3-phenoxypropylamino)ethanol.
| Compound Name | 1-(3-bromophenyl)-2-(3-phenoxypropylamino)ethanol |
|---|---|
| PubChem CID | 62380958 |
| Molecular Formula | C17H20BrNO2 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 1-(3-bromophenyl)-2-(3-phenoxypropylamino)ethanol |
| SMILES | OC(CNCCCOc1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H20BrNO2/c18-15-7-4-6-14(12-15)17(20)13-19-10-5-11-21-16-8-2-1-3-9-16/h1-4,6-9,12,17,19-20H,5,10-11,13H2 |
| InChIKey | YPJRNXMMTJTNCZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|