C15H24BrNO2 — CID 115578408
1-(3-bromophenyl)-2-(3-butoxypropylamino)ethanol (PubChem CID 115578408) has the molecular formula C15H24BrNO2 and a molecular weight of 330.27 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(3-butoxypropylamino)ethanol.
| Compound Name | 1-(3-bromophenyl)-2-(3-butoxypropylamino)ethanol |
|---|---|
| PubChem CID | 115578408 |
| Molecular Formula | C15H24BrNO2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 1-(3-bromophenyl)-2-(3-butoxypropylamino)ethanol |
| SMILES | CCCCOCCCNCC(O)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H24BrNO2/c1-2-3-9-19-10-5-8-17-12-15(18)13-6-4-7-14(16)11-13/h4,6-7,11,15,17-18H,2-3,5,8-10,12H2,1H3 |
| InChIKey | MRTHDDBXTVXMMO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|